C22H25FO4 — CID 145389577
[2-fluoro-4-(4-methoxyphenyl)phenyl] 2-methylprop-2-enoate;formaldehyde;2-methylprop-1-ene (PubChem CID 145389577) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is [2-fluoro-4-(4-methoxyphenyl)phenyl] 2-methylprop-2-enoate;formaldehyde;2-methylprop-1-ene.
| Compound Name | [2-fluoro-4-(4-methoxyphenyl)phenyl] 2-methylprop-2-enoate;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145389577 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [2-fluoro-4-(4-methoxyphenyl)phenyl] 2-methylprop-2-enoate;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)C(=O)Oc1ccc(-c2ccc(OC)cc2)cc1F.C=O |
| InChI | InChI=1S/C17H15FO3.C4H8.CH2O/c1-11(2)17(19)21-16-9-6-13(10-15(16)18)12-4-7-14(20-3)8-5-12;1-4(2)3;1-2/h4-10H,1H2,2-3H3;1H2,2-3H3;1H2 |
| InChIKey | PBKNJTXKPCOZKL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|