C20H19FO5 — CID 170072293
[2-fluoro-4-(3-methoxy-4-propanoyloxyphenyl)phenyl] 2-methylprop-2-enoate (PubChem CID 170072293) has the molecular formula C20H19FO5 and a molecular weight of 358.37 g/mol. Its IUPAC name is [2-fluoro-4-(3-methoxy-4-propanoyloxyphenyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-fluoro-4-(3-methoxy-4-propanoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170072293 |
| Molecular Formula | C20H19FO5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [2-fluoro-4-(3-methoxy-4-propanoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)CC)c(OC)c2)cc1F |
| InChI | InChI=1S/C20H19FO5/c1-5-19(22)25-17-9-7-14(11-18(17)24-4)13-6-8-16(15(21)10-13)26-20(23)12(2)3/h6-11H,2,5H2,1,3-4H3 |
| InChIKey | QJBDQXPIAZZBDK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|