C29H25F3O7 — CID 138636445
[4-[2-[2,6-difluoro-4-[3-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethoxy]-3-fluorophenyl] 2-methylprop-2-enoate (PubChem CID 138636445) has the molecular formula C29H25F3O7 and a molecular weight of 542.51 g/mol. Its IUPAC name is [4-[2-[2,6-difluoro-4-[3-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethoxy]-3-fluorophenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2,6-difluoro-4-[3-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethoxy]-3-fluorophenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138636445 |
| Molecular Formula | C29H25F3O7 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | [4-[2-[2,6-difluoro-4-[3-methoxy-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethoxy]-3-fluorophenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(OCCOc2c(F)cc(-c3ccc(OC(=O)C(=C)C)c(OC)c3)cc2F)c(F)c1 |
| InChI | InChI=1S/C29H25F3O7/c1-16(2)28(33)38-20-7-9-24(21(30)15-20)36-10-11-37-27-22(31)12-19(13-23(27)32)18-6-8-25(26(14-18)35-5)39-29(34)17(3)4/h6-9,12-15H,1,3,10-11H2,2,4-5H3 |
| InChIKey | QSDXHTDYDGKDGT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|