C23H23FO6 — CID 147073811
2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 147073811) has the molecular formula C23H23FO6 and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 147073811 |
| Molecular Formula | C23H23FO6 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OCCOC(=O)C(=C)COC)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23FO6/c1-15(2)22(25)30-19-8-5-17(6-9-19)18-7-10-21(20(24)13-18)28-11-12-29-23(26)16(3)14-27-4/h5-10,13H,1,3,11-12,14H2,2,4H3 |
| InChIKey | BFOISTIBRIHHSY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|