C38H46O8 — CID 146668879
2-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668879) has the molecular formula C38H46O8 and a molecular weight of 630.78 g/mol. Its IUPAC name is 2-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668879 |
| Molecular Formula | C38H46O8 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 2-[4-[4-(2-methylprop-2-enoyloxy)phenyl]-2-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(C2CCC(c3cc(-c4ccc(OC(=O)C(=C)C)cc4)ccc3OCCOC(=O)C(=C)COC)CC2)CC1 |
| InChI | InChI=1S/C38H46O8/c1-6-36(39)45-32-16-11-28(12-17-32)27-7-9-30(10-8-27)34-23-31(29-13-18-33(19-14-29)46-37(40)25(2)3)15-20-35(34)43-21-22-44-38(41)26(4)24-42-5/h6,13-15,18-20,23,27-28,30,32H,1-2,4,7-12,16-17,21-22,24H2,3,5H3 |
| InChIKey | FBFDRCDYMOOCQZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|