C30H30O7 — CID 149008109
2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 149008109) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 149008109 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)COC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30O7/c1-21(19-33-3)29(31)36-18-17-35-27-13-9-25(10-14-27)23-5-7-24(8-6-23)26-11-15-28(16-12-26)37-30(32)22(2)20-34-4/h5-16H,1-2,17-20H2,3-4H3 |
| InChIKey | QAZHPPFSJPEVPS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|