C29H31FO5 — CID 135247557
2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 135247557) has the molecular formula C29H31FO5 and a molecular weight of 478.56 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135247557 |
| Molecular Formula | C29H31FO5 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(O)cc3)cc2CCCCF)cc1 |
| InChI | InChI=1S/C29H31FO5/c1-21(20-33-2)29(32)35-18-17-34-27-13-8-23(9-14-27)28-15-10-24(19-25(28)5-3-4-16-30)22-6-11-26(31)12-7-22/h6-15,19,31H,1,3-5,16-18,20H2,2H3 |
| InChIKey | YSEZCHFTQQWCLQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|