C41H44O6 — CID 135247820
2-[4-[3-hexyl-4-[2-[4-[4-(2-methoxyethoxy)phenyl]phenyl]ethynyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135247820) has the molecular formula C41H44O6 and a molecular weight of 632.80 g/mol. Its IUPAC name is 2-[4-[3-hexyl-4-[2-[4-[4-(2-methoxyethoxy)phenyl]phenyl]ethynyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[3-hexyl-4-[2-[4-[4-(2-methoxyethoxy)phenyl]phenyl]ethynyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135247820 |
| Molecular Formula | C41H44O6 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | 2-[4-[3-hexyl-4-[2-[4-[4-(2-methoxyethoxy)phenyl]phenyl]ethynyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(C#Cc3ccc(-c4ccc(OCCOC)cc4)cc3)c(CCCCCC)c2)cc1 |
| InChI | InChI=1S/C41H44O6/c1-4-5-6-7-8-37-29-38(36-19-23-40(24-20-36)46-27-28-47-41(43)31(2)30-42)16-15-35(37)14-11-32-9-12-33(13-10-32)34-17-21-39(22-18-34)45-26-25-44-3/h9-10,12-13,15-24,29,42H,2,4-8,25-28,30H2,1,3H3 |
| InChIKey | KXPIZBDYVRSLPK-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|