C38H54O8 — CID 134245675
2-[4-heptyl-3-[3-heptyl-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245675) has the molecular formula C38H54O8 and a molecular weight of 638.84 g/mol. Its IUPAC name is 2-[4-heptyl-3-[3-heptyl-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-heptyl-3-[3-heptyl-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245675 |
| Molecular Formula | C38H54O8 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | 2-[4-heptyl-3-[3-heptyl-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(CCCCCCC)cc(-c2cc(OCCOC(=O)C(=C)CO)ccc2CCCCCCC)c1 |
| InChI | InChI=1S/C38H54O8/c1-5-7-9-11-13-15-31-23-33(25-35(24-31)44-20-22-46-38(42)30(4)28-40)36-26-34(43-19-21-45-37(41)29(3)27-39)18-17-32(36)16-14-12-10-8-6-2/h17-18,23-26,39-40H,3-16,19-22,27-28H2,1-2H3 |
| InChIKey | CDWOIVXUZKJQSG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|