C37H45FO8 — CID 134246035
2-[3-[4-[2-(3-fluoro-4-pentylphenyl)ethyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 3-hydroxy-2-methylpropanoate (PubChem CID 134246035) has the molecular formula C37H45FO8 and a molecular weight of 636.76 g/mol. Its IUPAC name is 2-[3-[4-[2-(3-fluoro-4-pentylphenyl)ethyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 3-hydroxy-2-methylpropanoate.
| Compound Name | 2-[3-[4-[2-(3-fluoro-4-pentylphenyl)ethyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 134246035 |
| Molecular Formula | C37H45FO8 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 2-[3-[4-[2-(3-fluoro-4-pentylphenyl)ethyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 3-hydroxy-2-methylpropanoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(C)CO)cc(-c2ccc(CCc3ccc(CCCCC)c(F)c3)cc2)c1 |
| InChI | InChI=1S/C37H45FO8/c1-4-5-6-7-31-15-12-29(20-35(31)38)9-8-28-10-13-30(14-11-28)32-21-33(43-16-18-45-36(41)26(2)24-39)23-34(22-32)44-17-19-46-37(42)27(3)25-40/h10-15,20-23,27,39-40H,2,4-9,16-19,24-25H2,1,3H3 |
| InChIKey | BXJOVZJFCUOVNF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|