C33H37F3O7 — CID 135247664
2-[3-(2-methoxyethoxy)-5-[4-[[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135247664) has the molecular formula C33H37F3O7 and a molecular weight of 602.65 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)-5-[4-[[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-(2-methoxyethoxy)-5-[4-[[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135247664 |
| Molecular Formula | C33H37F3O7 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)-5-[4-[[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC)cc(-c2ccc(OCc3ccc(CCCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C33H37F3O7/c1-24(22-37)32(38)42-18-17-41-31-20-28(19-30(21-31)40-16-15-39-2)27-10-12-29(13-11-27)43-23-26-8-6-25(7-9-26)5-3-4-14-33(34,35)36/h6-13,19-21,37H,1,3-5,14-18,22-23H2,2H3 |
| InChIKey | ZMWICJPFDBGGEC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|