C35H35FO8 — CID 134245996
2-[3-[4-[2-[4-(3-fluoropropyl)phenyl]ethynyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245996) has the molecular formula C35H35FO8 and a molecular weight of 602.65 g/mol. Its IUPAC name is 2-[3-[4-[2-[4-(3-fluoropropyl)phenyl]ethynyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[4-[2-[4-(3-fluoropropyl)phenyl]ethynyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245996 |
| Molecular Formula | C35H35FO8 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 2-[3-[4-[2-[4-(3-fluoropropyl)phenyl]ethynyl]phenyl]-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(=C)CO)cc(-c2ccc(C#Cc3ccc(CCCF)cc3)cc2)c1 |
| InChI | InChI=1S/C35H35FO8/c1-25(23-37)34(39)43-18-16-41-32-20-31(21-33(22-32)42-17-19-44-35(40)26(2)24-38)30-13-11-29(12-14-30)10-9-28-7-5-27(6-8-28)4-3-15-36/h5-8,11-14,20-22,37-38H,1-4,15-19,23-24H2 |
| InChIKey | FBKIBRQXONROFZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|