C29H34O8 — CID 134246552
2-[3-(4-but-3-enyl-2-ethylphenyl)-5-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246552) has the molecular formula C29H34O8 and a molecular weight of 510.58 g/mol. Its IUPAC name is 2-[3-(4-but-3-enyl-2-ethylphenyl)-5-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-(4-but-3-enyl-2-ethylphenyl)-5-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246552 |
| Molecular Formula | C29H34O8 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[3-(4-but-3-enyl-2-ethylphenyl)-5-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CCCc1ccc(-c2cc(OCCOC(=O)C(=C)CO)cc(OCOC(=O)C(=C)CO)c2)c(CC)c1 |
| InChI | InChI=1S/C29H34O8/c1-5-7-8-22-9-10-27(23(6-2)13-22)24-14-25(34-11-12-35-28(32)20(3)17-30)16-26(15-24)36-19-37-29(33)21(4)18-31/h5,9-10,13-16,30-31H,1,3-4,6-8,11-12,17-19H2,2H3 |
| InChIKey | IKJAJBQZVLGPKM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|