C34H46O8 — CID 135164242
2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]-3-pentylphenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164242) has the molecular formula C34H46O8 and a molecular weight of 582.73 g/mol. Its IUPAC name is 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]-3-pentylphenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]-3-pentylphenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164242 |
| Molecular Formula | C34H46O8 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]-3-pentylphenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(OCCOC(=O)C(=C)CO)cc2CCCCC)c(CCCCC)c1 |
| InChI | InChI=1S/C34H46O8/c1-5-7-9-11-27-21-29(39-17-19-41-33(37)25(3)23-35)13-15-31(27)32-16-14-30(22-28(32)12-10-8-6-2)40-18-20-42-34(38)26(4)24-36/h13-16,21-22,35-36H,3-12,17-20,23-24H2,1-2H3 |
| InChIKey | OJAJNPXFODNXER-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|