C33H56O10 — CID 139769952
2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 139769952) has the molecular formula C33H56O10 and a molecular weight of 612.80 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139769952 |
| Molecular Formula | C33H56O10 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCOCCOCCOCCOc1ccc(O)c(CCCCCCCCC)c1 |
| InChI | InChI=1S/C33H56O10/c1-4-5-6-7-8-9-10-11-30-28-31(12-13-32(30)34)42-26-24-40-22-20-38-18-16-36-14-15-37-17-19-39-21-23-41-25-27-43-33(35)29(2)3/h12-13,28,34H,2,4-11,14-27H2,1,3H3 |
| InChIKey | TYTDPZJGHBKFAQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|