C34H50O4 — CID 57273241
[4-(4-hydroxy-3-nonylphenoxy)-2-nonylphenyl] 2-methylprop-2-enoate (PubChem CID 57273241) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is [4-(4-hydroxy-3-nonylphenoxy)-2-nonylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(4-hydroxy-3-nonylphenoxy)-2-nonylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57273241 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | [4-(4-hydroxy-3-nonylphenoxy)-2-nonylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Oc2ccc(O)c(CCCCCCCCC)c2)cc1CCCCCCCCC |
| InChI | InChI=1S/C34H50O4/c1-5-7-9-11-13-15-17-19-28-25-30(21-23-32(28)35)37-31-22-24-33(38-34(36)27(3)4)29(26-31)20-18-16-14-12-10-8-6-2/h21-26,35H,3,5-20H2,1-2,4H3 |
| InChIKey | QHDSMTLGDSRHJG-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|