C33H54O10 — CID 139769959
2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenyl)acetyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 139769959) has the molecular formula C33H54O10 and a molecular weight of 610.79 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenyl)acetyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenyl)acetyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139769959 |
| Molecular Formula | C33H54O10 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(4-hydroxy-3-nonylphenyl)acetyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCOCCOCCOC(=O)Cc1ccc(O)c(CCCCCCCCC)c1 |
| InChI | InChI=1S/C33H54O10/c1-4-5-6-7-8-9-10-11-30-26-29(12-13-31(30)34)27-32(35)42-24-22-40-20-18-38-16-14-37-15-17-39-19-21-41-23-25-43-33(36)28(2)3/h12-13,26,34H,2,4-11,14-25,27H2,1,3H3 |
| InChIKey | JPMIZMKYLXGGMU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|