About 4-nonyl-2-pentylphenol
4-nonyl-2-pentylphenol (PubChem CID 86162849) has the molecular formula C20H34O
and a molecular weight of 290.49 g/mol. Its IUPAC name is 4-nonyl-2-pentylphenol.
Molecular Properties
| Compound Name | 4-nonyl-2-pentylphenol |
| PubChem CID | 86162849 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 4-nonyl-2-pentylphenol |
| SMILES | CCCCCCCCCc1ccc(O)c(CCCCC)c1 |
| InChI | InChI=1S/C20H34O/c1-3-5-7-8-9-10-12-13-18-15-16-20(21)19(17-18)14-11-6-4-2/h15-17,21H,3-14H2,1-2H3 |
| InChIKey | MJROPBMPOYHTFU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nonyl-2-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonyl-2-pentylphenol?
The IUPAC name of 4-nonyl-2-pentylphenol (CID 86162849) is 4-nonyl-2-pentylphenol.
What is the SMILES notation for 4-nonyl-2-pentylphenol?
The canonical SMILES for 4-nonyl-2-pentylphenol is CCCCCCCCCc1ccc(O)c(CCCCC)c1.
What is the InChIKey of 4-nonyl-2-pentylphenol?
The InChIKey is MJROPBMPOYHTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O/c1-3-5-7-8-9-10-12-13-18-15-16-20(21)19(17-18)14-11-6-4-2/h15-17,21H,3-14H2,1-2H3.
What are the key properties of 4-nonyl-2-pentylphenol?
4-nonyl-2-pentylphenol has a molecular weight of 290.49 g/mol, XLogP of 6.42, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonyl-2-pentylphenol is sourced from PubChem (CID 86162849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).