C22H38O — CID 169030175
4-(3,4-dihexylphenyl)butan-1-ol (PubChem CID 169030175) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 4-(3,4-dihexylphenyl)butan-1-ol.
| Compound Name | 4-(3,4-dihexylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 169030175 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 4-(3,4-dihexylphenyl)butan-1-ol |
| SMILES | CCCCCCc1ccc(CCCCO)cc1CCCCCC |
| InChI | InChI=1S/C22H38O/c1-3-5-7-9-14-21-17-16-20(13-11-12-18-23)19-22(21)15-10-8-6-4-2/h16-17,19,23H,3-15,18H2,1-2H3 |
| InChIKey | LOCNYDYREJUQGP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|