About sodium 2-dodecylbenzene-1,4-diol
sodium 2-dodecylbenzene-1,4-diol (PubChem CID 23460783) has the molecular formula C18H30NaO2+
and a molecular weight of 301.43 g/mol. Its IUPAC name is sodium 2-dodecylbenzene-1,4-diol.
Molecular Properties
| Compound Name | sodium 2-dodecylbenzene-1,4-diol |
| PubChem CID | 23460783 |
| Molecular Formula | C18H30NaO2+ |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | sodium 2-dodecylbenzene-1,4-diol |
| SMILES | CCCCCCCCCCCCc1cc(O)ccc1O.[Na+] |
| InChI | InChI=1S/C18H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-15-17(19)13-14-18(16)20;/h13-15,19-20H,2-12H2,1H3;/q;+1 |
| InChIKey | SBKICSVRRANUKL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-dodecylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-dodecylbenzene-1,4-diol?
The IUPAC name of sodium 2-dodecylbenzene-1,4-diol (CID 23460783) is sodium 2-dodecylbenzene-1,4-diol.
What is the SMILES notation for sodium 2-dodecylbenzene-1,4-diol?
The canonical SMILES for sodium 2-dodecylbenzene-1,4-diol is CCCCCCCCCCCCc1cc(O)ccc1O.[Na+].
What is the InChIKey of sodium 2-dodecylbenzene-1,4-diol?
The InChIKey is SBKICSVRRANUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-15-17(19)13-14-18(16)20;/h13-15,19-20H,2-12H2,1H3;/q;+1.
What are the key properties of sodium 2-dodecylbenzene-1,4-diol?
sodium 2-dodecylbenzene-1,4-diol has a molecular weight of 301.43 g/mol, XLogP of 2.57, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-dodecylbenzene-1,4-diol is sourced from PubChem (CID 23460783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).