C23H26O2 — CID 68959503
4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]-2-pentylphenol (PubChem CID 68959503) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]-2-pentylphenol.
| Compound Name | 4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]-2-pentylphenol |
|---|---|
| PubChem CID | 68959503 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]-2-pentylphenol |
| SMILES | CCCCCc1cc(C2=CCC(c3ccc(O)cc3)=CC2)ccc1O |
| InChI | InChI=1S/C23H26O2/c1-2-3-4-5-21-16-20(12-15-23(21)25)19-8-6-17(7-9-19)18-10-13-22(24)14-11-18/h6,9-16,24-25H,2-5,7-8H2,1H3 |
| InChIKey | FONLFIDITPBOGO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|