About 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol
2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol (PubChem CID 68961421) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol.
Molecular Properties
| Compound Name | 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol |
| PubChem CID | 68961421 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol |
| SMILES | CCc1cc(C2=CCC(c3ccc(O)cc3)=CC2)ccc1O |
| InChI | InChI=1S/C20H20O2/c1-2-14-13-18(9-12-20(14)22)17-5-3-15(4-6-17)16-7-10-19(21)11-8-16/h3,6-13,21-22H,2,4-5H2,1H3 |
| InChIKey | BZRAMFXXVRBGKW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol?
The IUPAC name of 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol (CID 68961421) is 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol.
What is the SMILES notation for 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol?
The canonical SMILES for 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol is CCc1cc(C2=CCC(c3ccc(O)cc3)=CC2)ccc1O.
What is the InChIKey of 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol?
The InChIKey is BZRAMFXXVRBGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O2/c1-2-14-13-18(9-12-20(14)22)17-5-3-15(4-6-17)16-7-10-19(21)11-8-16/h3,6-13,21-22H,2,4-5H2,1H3.
What are the key properties of 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol?
2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol has a molecular weight of 292.38 g/mol, XLogP of 4.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[4-(4-hydroxyphenyl)cyclohexa-1,4-dien-1-yl]phenol is sourced from PubChem (CID 68961421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).