About 3-methyl-4-octylphenol
3-methyl-4-octylphenol (PubChem CID 67863636) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-methyl-4-octylphenol.
Molecular Properties
| Compound Name | 3-methyl-4-octylphenol |
| PubChem CID | 67863636 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 3-methyl-4-octylphenol |
| SMILES | CCCCCCCCc1ccc(O)cc1C |
| InChI | InChI=1S/C15H24O/c1-3-4-5-6-7-8-9-14-10-11-15(16)12-13(14)2/h10-12,16H,3-9H2,1-2H3 |
| InChIKey | RNHUXZFRJZKVCZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-octylphenol?
The IUPAC name of 3-methyl-4-octylphenol (CID 67863636) is 3-methyl-4-octylphenol.
What is the SMILES notation for 3-methyl-4-octylphenol?
The canonical SMILES for 3-methyl-4-octylphenol is CCCCCCCCc1ccc(O)cc1C.
What is the InChIKey of 3-methyl-4-octylphenol?
The InChIKey is RNHUXZFRJZKVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-3-4-5-6-7-8-9-14-10-11-15(16)12-13(14)2/h10-12,16H,3-9H2,1-2H3.
What are the key properties of 3-methyl-4-octylphenol?
3-methyl-4-octylphenol has a molecular weight of 220.36 g/mol, XLogP of 4.60, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-octylphenol is sourced from PubChem (CID 67863636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).