About 5,6-dihexylnaphthalen-2-ol
5,6-dihexylnaphthalen-2-ol (PubChem CID 67259351) has the molecular formula C22H32O
and a molecular weight of 312.50 g/mol. Its IUPAC name is 5,6-dihexylnaphthalen-2-ol.
Molecular Properties
| Compound Name | 5,6-dihexylnaphthalen-2-ol |
| PubChem CID | 67259351 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 5,6-dihexylnaphthalen-2-ol |
| SMILES | CCCCCCc1ccc2cc(O)ccc2c1CCCCCC |
| InChI | InChI=1S/C22H32O/c1-3-5-7-9-11-18-13-14-19-17-20(23)15-16-22(19)21(18)12-10-8-6-4-2/h13-17,23H,3-12H2,1-2H3 |
| InChIKey | SDNJJYYHSMEAGE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihexylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihexylnaphthalen-2-ol?
The IUPAC name of 5,6-dihexylnaphthalen-2-ol (CID 67259351) is 5,6-dihexylnaphthalen-2-ol.
What is the SMILES notation for 5,6-dihexylnaphthalen-2-ol?
The canonical SMILES for 5,6-dihexylnaphthalen-2-ol is CCCCCCc1ccc2cc(O)ccc2c1CCCCCC.
What is the InChIKey of 5,6-dihexylnaphthalen-2-ol?
The InChIKey is SDNJJYYHSMEAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O/c1-3-5-7-9-11-18-13-14-19-17-20(23)15-16-22(19)21(18)12-10-8-6-4-2/h13-17,23H,3-12H2,1-2H3.
What are the key properties of 5,6-dihexylnaphthalen-2-ol?
5,6-dihexylnaphthalen-2-ol has a molecular weight of 312.50 g/mol, XLogP of 6.79, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihexylnaphthalen-2-ol is sourced from PubChem (CID 67259351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).