About 3-methyl-4-octylaniline
3-methyl-4-octylaniline (PubChem CID 139523093) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-methyl-4-octylaniline.
Molecular Properties
| Compound Name | 3-methyl-4-octylaniline |
| PubChem CID | 139523093 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-methyl-4-octylaniline |
| SMILES | CCCCCCCCc1ccc(N)cc1C |
| InChI | InChI=1S/C15H25N/c1-3-4-5-6-7-8-9-14-10-11-15(16)12-13(14)2/h10-12H,3-9,16H2,1-2H3 |
| InChIKey | RCBYIOBGSFJQOD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-octylaniline?
The IUPAC name of 3-methyl-4-octylaniline (CID 139523093) is 3-methyl-4-octylaniline.
What is the SMILES notation for 3-methyl-4-octylaniline?
The canonical SMILES for 3-methyl-4-octylaniline is CCCCCCCCc1ccc(N)cc1C.
What is the InChIKey of 3-methyl-4-octylaniline?
The InChIKey is RCBYIOBGSFJQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-3-4-5-6-7-8-9-14-10-11-15(16)12-13(14)2/h10-12H,3-9,16H2,1-2H3.
What are the key properties of 3-methyl-4-octylaniline?
3-methyl-4-octylaniline has a molecular weight of 219.37 g/mol, XLogP of 4.48, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-octylaniline is sourced from PubChem (CID 139523093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).