About 4-fluoro-3-octylaniline
4-fluoro-3-octylaniline (PubChem CID 70083692) has the molecular formula C14H22FN
and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-fluoro-3-octylaniline.
Molecular Properties
| Compound Name | 4-fluoro-3-octylaniline |
| PubChem CID | 70083692 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-fluoro-3-octylaniline |
| SMILES | CCCCCCCCc1cc(N)ccc1F |
| InChI | InChI=1S/C14H22FN/c1-2-3-4-5-6-7-8-12-11-13(16)9-10-14(12)15/h9-11H,2-8,16H2,1H3 |
| InChIKey | GEJYCFMCLVHRPC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-octylaniline?
The IUPAC name of 4-fluoro-3-octylaniline (CID 70083692) is 4-fluoro-3-octylaniline.
What is the SMILES notation for 4-fluoro-3-octylaniline?
The canonical SMILES for 4-fluoro-3-octylaniline is CCCCCCCCc1cc(N)ccc1F.
What is the InChIKey of 4-fluoro-3-octylaniline?
The InChIKey is GEJYCFMCLVHRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FN/c1-2-3-4-5-6-7-8-12-11-13(16)9-10-14(12)15/h9-11H,2-8,16H2,1H3.
What are the key properties of 4-fluoro-3-octylaniline?
4-fluoro-3-octylaniline has a molecular weight of 223.34 g/mol, XLogP of 4.31, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-octylaniline is sourced from PubChem (CID 70083692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).