About 3-chloro-4-hexylaniline
3-chloro-4-hexylaniline (PubChem CID 139793989) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is 3-chloro-4-hexylaniline.
Molecular Properties
| Compound Name | 3-chloro-4-hexylaniline |
| PubChem CID | 139793989 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-chloro-4-hexylaniline |
| SMILES | CCCCCCc1ccc(N)cc1Cl |
| InChI | InChI=1S/C12H18ClN/c1-2-3-4-5-6-10-7-8-11(14)9-12(10)13/h7-9H,2-6,14H2,1H3 |
| InChIKey | JIEMCYLDXOWEMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-hexylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-hexylaniline?
The IUPAC name of 3-chloro-4-hexylaniline (CID 139793989) is 3-chloro-4-hexylaniline.
What is the SMILES notation for 3-chloro-4-hexylaniline?
The canonical SMILES for 3-chloro-4-hexylaniline is CCCCCCc1ccc(N)cc1Cl.
What is the InChIKey of 3-chloro-4-hexylaniline?
The InChIKey is JIEMCYLDXOWEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN/c1-2-3-4-5-6-10-7-8-11(14)9-12(10)13/h7-9H,2-6,14H2,1H3.
What are the key properties of 3-chloro-4-hexylaniline?
3-chloro-4-hexylaniline has a molecular weight of 211.74 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-hexylaniline is sourced from PubChem (CID 139793989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).