About 5-amino-2-nonylphenol
5-amino-2-nonylphenol (PubChem CID 152595596) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-amino-2-nonylphenol.
Molecular Properties
| Compound Name | 5-amino-2-nonylphenol |
| PubChem CID | 152595596 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 5-amino-2-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(N)cc1O |
| InChI | InChI=1S/C15H25NO/c1-2-3-4-5-6-7-8-9-13-10-11-14(16)12-15(13)17/h10-12,17H,2-9,16H2,1H3 |
| InChIKey | YWKGRDFYJJXQOX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-nonylphenol?
The IUPAC name of 5-amino-2-nonylphenol (CID 152595596) is 5-amino-2-nonylphenol.
What is the SMILES notation for 5-amino-2-nonylphenol?
The canonical SMILES for 5-amino-2-nonylphenol is CCCCCCCCCc1ccc(N)cc1O.
What is the InChIKey of 5-amino-2-nonylphenol?
The InChIKey is YWKGRDFYJJXQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-2-3-4-5-6-7-8-9-13-10-11-14(16)12-15(13)17/h10-12,17H,2-9,16H2,1H3.
What are the key properties of 5-amino-2-nonylphenol?
5-amino-2-nonylphenol has a molecular weight of 235.37 g/mol, XLogP of 4.27, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-nonylphenol is sourced from PubChem (CID 152595596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).