About 5-ethoxy-2-hexylphenol
5-ethoxy-2-hexylphenol (PubChem CID 3021981) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-ethoxy-2-hexylphenol.
Molecular Properties
| Compound Name | 5-ethoxy-2-hexylphenol |
| PubChem CID | 3021981 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 5-ethoxy-2-hexylphenol |
| SMILES | CCCCCCc1ccc(OCC)cc1O |
| InChI | InChI=1S/C14H22O2/c1-3-5-6-7-8-12-9-10-13(16-4-2)11-14(12)15/h9-11,15H,3-8H2,1-2H3 |
| InChIKey | HTCNWWOBQWBRBH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-2-hexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-hexylphenol?
The IUPAC name of 5-ethoxy-2-hexylphenol (CID 3021981) is 5-ethoxy-2-hexylphenol.
What is the SMILES notation for 5-ethoxy-2-hexylphenol?
The canonical SMILES for 5-ethoxy-2-hexylphenol is CCCCCCc1ccc(OCC)cc1O.
What is the InChIKey of 5-ethoxy-2-hexylphenol?
The InChIKey is HTCNWWOBQWBRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-5-6-7-8-12-9-10-13(16-4-2)11-14(12)15/h9-11,15H,3-8H2,1-2H3.
What are the key properties of 5-ethoxy-2-hexylphenol?
5-ethoxy-2-hexylphenol has a molecular weight of 222.33 g/mol, XLogP of 3.91, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-hexylphenol is sourced from PubChem (CID 3021981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).