About 5-chloro-2-dodecylphenol
5-chloro-2-dodecylphenol (PubChem CID 102279992) has the molecular formula C18H29ClO
and a molecular weight of 296.88 g/mol. Its IUPAC name is 5-chloro-2-dodecylphenol.
Molecular Properties
| Compound Name | 5-chloro-2-dodecylphenol |
| PubChem CID | 102279992 |
| Molecular Formula | C18H29ClO |
| Molecular Weight | 296.88 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 5-chloro-2-dodecylphenol |
| SMILES | CCCCCCCCCCCCc1ccc(Cl)cc1O |
| InChI | InChI=1S/C18H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15-18(16)20/h13-15,20H,2-12H2,1H3 |
| InChIKey | QQRHNYDNNXYPJO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-dodecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-dodecylphenol?
The IUPAC name of 5-chloro-2-dodecylphenol (CID 102279992) is 5-chloro-2-dodecylphenol.
What is the SMILES notation for 5-chloro-2-dodecylphenol?
The canonical SMILES for 5-chloro-2-dodecylphenol is CCCCCCCCCCCCc1ccc(Cl)cc1O.
What is the InChIKey of 5-chloro-2-dodecylphenol?
The InChIKey is QQRHNYDNNXYPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15-18(16)20/h13-15,20H,2-12H2,1H3.
What are the key properties of 5-chloro-2-dodecylphenol?
5-chloro-2-dodecylphenol has a molecular weight of 296.88 g/mol, XLogP of 6.51, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-dodecylphenol is sourced from PubChem (CID 102279992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).