C22H24N2O5 — CID 150202611
[2-(aminomethyl)-4-[3-(aminomethyl)-4-(2-methylprop-2-enoyloxy)phenoxy]phenyl] 2-methylprop-2-enoate (PubChem CID 150202611) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(aminomethyl)-4-[3-(aminomethyl)-4-(2-methylprop-2-enoyloxy)phenoxy]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-(aminomethyl)-4-[3-(aminomethyl)-4-(2-methylprop-2-enoyloxy)phenoxy]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150202611 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(aminomethyl)-4-[3-(aminomethyl)-4-(2-methylprop-2-enoyloxy)phenoxy]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Oc2ccc(OC(=O)C(=C)C)c(CN)c2)cc1CN |
| InChI | InChI=1S/C22H24N2O5/c1-13(2)21(25)28-19-7-5-17(9-15(19)11-23)27-18-6-8-20(16(10-18)12-24)29-22(26)14(3)4/h5-10H,1,3,11-12,23-24H2,2,4H3 |
| InChIKey | FPURTHSUPHPTQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|