C26H26O4 — CID 166561353
[4-[4-(2-methylprop-2-enoyloxy)-3-prop-2-enylphenyl]-3-prop-2-enylphenyl] 2-methylprop-2-enoate (PubChem CID 166561353) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxy)-3-prop-2-enylphenyl]-3-prop-2-enylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxy)-3-prop-2-enylphenyl]-3-prop-2-enylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166561353 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxy)-3-prop-2-enylphenyl]-3-prop-2-enylphenyl] 2-methylprop-2-enoate |
| SMILES | C=CCc1cc(-c2ccc(OC(=O)C(=C)C)cc2CC=C)ccc1OC(=O)C(=C)C |
| InChI | InChI=1S/C26H26O4/c1-7-9-19-16-22(29-25(27)17(3)4)12-13-23(19)20-11-14-24(21(15-20)10-8-2)30-26(28)18(5)6/h7-8,11-16H,1-3,5,9-10H2,4,6H3 |
| InChIKey | ALBOVNGTUDHNCV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|