C42H36O8 — CID 123832277
[4-[2-[4-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]ethenyl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 123832277) has the molecular formula C42H36O8 and a molecular weight of 668.74 g/mol. Its IUPAC name is [4-[2-[4-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]ethenyl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]ethenyl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123832277 |
| Molecular Formula | C42H36O8 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | [4-[2-[4-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]ethenyl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C=Cc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)cc4OC(=O)C(=C)C)cc3)cc2)c(OC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C42H36O8/c1-25(2)39(43)47-34-20-19-33(37(23-34)49-41(45)27(5)6)14-11-29-9-12-30(13-10-29)31-15-17-32(18-16-31)36-22-21-35(48-40(44)26(3)4)24-38(36)50-42(46)28(7)8/h9-24H,1,3,5,7H2,2,4,6,8H3 |
| InChIKey | FHQQUCOUGSFDCD-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|