C31H28O6 — CID 154625023
4-O-methyl 1-O-[4-[(E)-2-[4-[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylidenebutanedioate (PubChem CID 154625023) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[(E)-2-[4-[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[(E)-2-[4-[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625023 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-O-methyl 1-O-[4-[(E)-2-[4-[2-methyl-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(/C=C/c3ccc(OC(=O)C(=C)CC(=O)OC)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H28O6/c1-20(2)30(33)37-27-16-17-28(21(3)18-27)25-12-8-23(9-13-25)6-7-24-10-14-26(15-11-24)36-31(34)22(4)19-29(32)35-5/h6-18H,1,4,19H2,2-3,5H3/b7-6+ |
| InChIKey | QHHKCUMPSNDWIU-VOTSOKGWSA-N |
| XLogP | 6.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|