C30H24O7 — CID 154625041
4-O-methyl 1-O-[4-[(E)-3-[4-(4-prop-2-enoyloxyphenyl)phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate (PubChem CID 154625041) has the molecular formula C30H24O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[(E)-3-[4-(4-prop-2-enoyloxyphenyl)phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[(E)-3-[4-(4-prop-2-enoyloxyphenyl)phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625041 |
| Molecular Formula | C30H24O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-O-methyl 1-O-[4-[(E)-3-[4-(4-prop-2-enoyloxyphenyl)phenyl]prop-2-enoyl]phenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(/C=C/C(=O)c3ccc(OC(=O)C(=C)CC(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H24O7/c1-4-28(32)36-25-14-10-23(11-15-25)22-8-5-21(6-9-22)7-18-27(31)24-12-16-26(17-13-24)37-30(34)20(2)19-29(33)35-3/h4-18H,1-2,19H2,3H3/b18-7+ |
| InChIKey | CIAGWSBRLSTVJP-CNHKJKLMSA-N |
| XLogP | 5.37 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|