C36H36O10 — CID 147558435
1-O-[3-[4-[(E)-3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]-3-oxoprop-1-enyl]phenoxy]propyl] 4-O-methyl 2-methylidenebutanedioate (PubChem CID 147558435) has the molecular formula C36H36O10 and a molecular weight of 628.67 g/mol. Its IUPAC name is 1-O-[3-[4-[(E)-3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]-3-oxoprop-1-enyl]phenoxy]propyl] 4-O-methyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[3-[4-[(E)-3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]-3-oxoprop-1-enyl]phenoxy]propyl] 4-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 147558435 |
| Molecular Formula | C36H36O10 |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 1-O-[3-[4-[(E)-3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]-3-oxoprop-1-enyl]phenoxy]propyl] 4-O-methyl 2-methylidenebutanedioate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(C(=O)/C=C/c3ccc(OCCCOC(=O)C(=C)CC(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H36O10/c1-25(23-34(39)42-3)35(40)45-20-4-19-43-31-14-5-27(6-15-31)7-18-33(38)30-10-8-28(9-11-30)29-12-16-32(17-13-29)44-21-22-46-36(41)26(2)24-37/h5-18,37H,1-2,4,19-24H2,3H3/b18-7+ |
| InChIKey | FSDJLIXRHPGFJL-CNHKJKLMSA-N |
| XLogP | 5.15 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|