C34H38O9 — CID 154624814
4-O-cyclohexyl 1-O-[2-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]ethyl] 2-methylidenebutanedioate (PubChem CID 154624814) has the molecular formula C34H38O9 and a molecular weight of 590.67 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[2-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]ethyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[2-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]ethyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624814 |
| Molecular Formula | C34H38O9 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[2-[4-[(E)-3-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]ethyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(=O)/C=C/c2ccc(OCCOC(=O)C(=C)CC(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H38O9/c1-24(2)33(37)41-21-19-40-29-16-12-27(13-17-29)31(35)18-11-26-9-14-28(15-10-26)39-20-22-42-34(38)25(3)23-32(36)43-30-7-5-4-6-8-30/h9-18,30H,1,3-8,19-23H2,2H3/b18-11+ |
| InChIKey | SMWBRGIZTWVLRB-WOJGMQOQSA-N |
| XLogP | 5.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|