C37H38O9 — CID 154625205
4-O-cyclohexyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenoxy]carbonylphenyl] 2-methylidenebutanedioate (PubChem CID 154625205) has the molecular formula C37H38O9 and a molecular weight of 626.70 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenoxy]carbonylphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenoxy]carbonylphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625205 |
| Molecular Formula | C37H38O9 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenoxy]carbonylphenyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)C(=C)CC(=O)OC4CCCCC4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C37H38O9/c1-24(2)35(39)43-21-20-42-30-15-10-27(11-16-30)28-12-17-32(18-13-28)45-37(41)29-14-19-33(25(3)22-29)46-36(40)26(4)23-34(38)44-31-8-6-5-7-9-31/h10-19,22,31H,1,4-9,20-21,23H2,2-3H3 |
| InChIKey | MJXSXAHKLGEQBQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|