C39H33FO8 — CID 139409112
4-O-cyclohexyl 1-O-[4-[4-[4-[4-(2-fluoroprop-2-enoyloxy)benzoyl]oxyphenyl]phenyl]phenyl] 2-methylidenebutanedioate (PubChem CID 139409112) has the molecular formula C39H33FO8 and a molecular weight of 648.68 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[4-[4-[4-[4-(2-fluoroprop-2-enoyloxy)benzoyl]oxyphenyl]phenyl]phenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[4-[4-[4-[4-(2-fluoroprop-2-enoyloxy)benzoyl]oxyphenyl]phenyl]phenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 139409112 |
| Molecular Formula | C39H33FO8 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[4-[4-[4-[4-(2-fluoroprop-2-enoyloxy)benzoyl]oxyphenyl]phenyl]phenyl] 2-methylidenebutanedioate |
| SMILES | C=C(F)C(=O)Oc1ccc(C(=O)Oc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)CC(=O)OC5CCCCC5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H33FO8/c1-25(24-36(41)45-32-6-4-3-5-7-32)37(42)46-33-18-12-29(13-19-33)27-8-10-28(11-9-27)30-14-20-35(21-15-30)48-39(44)31-16-22-34(23-17-31)47-38(43)26(2)40/h8-23,32H,1-7,24H2 |
| InChIKey | SIIZUTRPGGDEQW-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|