C36H35FO9 — CID 154624836
4-O-cyclohexyl 1-O-[4-[4-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate (PubChem CID 154624836) has the molecular formula C36H35FO9 and a molecular weight of 630.67 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[4-[4-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[4-[4-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624836 |
| Molecular Formula | C36H35FO9 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[4-[4-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(=O)C(=C)CC(=O)OC4CCCCC4)cc3)cc2)cc1F |
| InChI | InChI=1S/C36H35FO9/c1-3-33(38)43-21-7-20-42-32-19-14-27(23-31(32)37)25-10-12-26(13-11-25)36(41)46-30-17-15-29(16-18-30)45-35(40)24(2)22-34(39)44-28-8-5-4-6-9-28/h3,10-19,23,28H,1-2,4-9,20-22H2 |
| InChIKey | WEYWRNXOZWORNL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|