C43H44O9S — CID 155241573
4-O-cyclohexyl 1-O-[3-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxypropyl] 2-methylidenebutanedioate (PubChem CID 155241573) has the molecular formula C43H44O9S and a molecular weight of 736.88 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[3-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxypropyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[3-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxypropyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155241573 |
| Molecular Formula | C43H44O9S |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.27 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[3-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxypropyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(SC(=O)c3ccc4cc(OCCCOC(=O)C(=C)CC(=O)OC5CCCCC5)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C43H44O9S/c1-3-40(44)50-25-7-23-48-36-18-13-31(14-19-36)32-16-21-39(22-17-32)53-43(47)35-12-11-34-29-38(20-15-33(34)28-35)49-24-8-26-51-42(46)30(2)27-41(45)52-37-9-5-4-6-10-37/h3,11-22,28-29,37H,1-2,4-10,23-27H2 |
| InChIKey | NSCDUXGLJDCZNI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|