C39H42O7S — CID 155241615
6-[4-[7-(6-prop-2-enoyloxyhexoxy)phenanthrene-2-carbonyl]sulfanylphenoxy]hexyl prop-2-enoate (PubChem CID 155241615) has the molecular formula C39H42O7S and a molecular weight of 654.83 g/mol. Its IUPAC name is 6-[4-[7-(6-prop-2-enoyloxyhexoxy)phenanthrene-2-carbonyl]sulfanylphenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[7-(6-prop-2-enoyloxyhexoxy)phenanthrene-2-carbonyl]sulfanylphenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 155241615 |
| Molecular Formula | C39H42O7S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | 6-[4-[7-(6-prop-2-enoyloxyhexoxy)phenanthrene-2-carbonyl]sulfanylphenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(SC(=O)c2ccc3c(ccc4cc(OCCCCCCOC(=O)C=C)ccc43)c2)cc1 |
| InChI | InChI=1S/C39H42O7S/c1-3-37(40)45-25-11-7-5-9-23-43-32-16-19-34(20-17-32)47-39(42)31-15-21-35-29(27-31)13-14-30-28-33(18-22-36(30)35)44-24-10-6-8-12-26-46-38(41)4-2/h3-4,13-22,27-28H,1-2,5-12,23-26H2 |
| InChIKey | SXRWVGWAVQRGGQ-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|