C34H30O6S — CID 155241826
[4-[4-[6-(4-prop-2-enoyloxybutoxy)naphthalen-2-yl]benzoyl]sulfanylphenyl] 2-methylprop-2-enoate (PubChem CID 155241826) has the molecular formula C34H30O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is [4-[4-[6-(4-prop-2-enoyloxybutoxy)naphthalen-2-yl]benzoyl]sulfanylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[6-(4-prop-2-enoyloxybutoxy)naphthalen-2-yl]benzoyl]sulfanylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155241826 |
| Molecular Formula | C34H30O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [4-[4-[6-(4-prop-2-enoyloxybutoxy)naphthalen-2-yl]benzoyl]sulfanylphenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2cc(-c3ccc(C(=O)Sc4ccc(OC(=O)C(=C)C)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C34H30O6S/c1-4-32(35)39-20-6-5-19-38-30-14-13-27-21-26(11-12-28(27)22-30)24-7-9-25(10-8-24)34(37)41-31-17-15-29(16-18-31)40-33(36)23(2)3/h4,7-18,21-22H,1-2,5-6,19-20H2,3H3 |
| InChIKey | WLMDXIOEPLYUDX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|