C36H40O7S — CID 155241765
ethenyl 6-[4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]sulfanylphenoxy]hexanoate (PubChem CID 155241765) has the molecular formula C36H40O7S and a molecular weight of 616.78 g/mol. Its IUPAC name is ethenyl 6-[4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]sulfanylphenoxy]hexanoate.
| Compound Name | ethenyl 6-[4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]sulfanylphenoxy]hexanoate |
|---|---|
| PubChem CID | 155241765 |
| Molecular Formula | C36H40O7S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | ethenyl 6-[4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]sulfanylphenoxy]hexanoate |
| SMILES | C=COC(=O)CCCCCOc1ccc(SC(=O)c2ccc(-c3ccc(OCCCCCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H40O7S/c1-3-34(37)43-27-10-6-5-9-25-41-31-19-17-29(18-20-31)28-13-15-30(16-14-28)36(39)44-33-23-21-32(22-24-33)42-26-11-7-8-12-35(38)40-4-2/h3-4,13-24H,1-2,5-12,25-27H2 |
| InChIKey | OLLSPJVWODLVMT-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|