C31H30O7S — CID 155241438
4-[4-[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl]sulfanylcarbonylphenoxy]butyl prop-2-enoate (PubChem CID 155241438) has the molecular formula C31H30O7S and a molecular weight of 546.64 g/mol. Its IUPAC name is 4-[4-[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl]sulfanylcarbonylphenoxy]butyl prop-2-enoate.
| Compound Name | 4-[4-[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl]sulfanylcarbonylphenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 155241438 |
| Molecular Formula | C31H30O7S |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 4-[4-[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl]sulfanylcarbonylphenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Sc2ccc(-c3ccc(OCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H30O7S/c1-3-29(32)37-20-6-5-19-35-26-15-9-25(10-16-26)31(34)39-28-17-11-24(12-18-28)23-7-13-27(14-8-23)36-21-22-38-30(33)4-2/h3-4,7-18H,1-2,5-6,19-22H2 |
| InChIKey | NKUDDOOAWLGLDH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|