C38H38O7S — CID 155241570
6-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxyhexyl prop-2-enoate (PubChem CID 155241570) has the molecular formula C38H38O7S and a molecular weight of 638.78 g/mol. Its IUPAC name is 6-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxyhexyl prop-2-enoate.
| Compound Name | 6-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 155241570 |
| Molecular Formula | C38H38O7S |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 6-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenyl]sulfanylcarbonylnaphthalen-2-yl]oxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C(=O)Sc3ccc(-c4ccc(OCCCOC(=O)C=C)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C38H38O7S/c1-3-36(39)44-23-8-6-5-7-22-43-34-19-14-30-26-32(11-10-31(30)27-34)38(41)46-35-20-15-29(16-21-35)28-12-17-33(18-13-28)42-24-9-25-45-37(40)4-2/h3-4,10-21,26-27H,1-2,5-9,22-25H2 |
| InChIKey | KYCWBJIGULLRPW-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|