C32H28O6S — CID 155241426
[4-[7-(4-prop-2-enoyloxybutoxy)phenanthrene-2-carbonyl]sulfanylphenyl] 2-methylprop-2-enoate (PubChem CID 155241426) has the molecular formula C32H28O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is [4-[7-(4-prop-2-enoyloxybutoxy)phenanthrene-2-carbonyl]sulfanylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[7-(4-prop-2-enoyloxybutoxy)phenanthrene-2-carbonyl]sulfanylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155241426 |
| Molecular Formula | C32H28O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [4-[7-(4-prop-2-enoyloxybutoxy)phenanthrene-2-carbonyl]sulfanylphenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2c(ccc3cc(C(=O)Sc4ccc(OC(=O)C(=C)C)cc4)ccc32)c1 |
| InChI | InChI=1S/C32H28O6S/c1-4-30(33)37-18-6-5-17-36-26-12-16-29-23(20-26)8-7-22-19-24(9-15-28(22)29)32(35)39-27-13-10-25(11-14-27)38-31(34)21(2)3/h4,7-16,19-20H,1-2,5-6,17-18H2,3H3 |
| InChIKey | NXTXESXYENXBLP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|