C35H34O9S — CID 155242054
2-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]ethyl 2-methylprop-2-enoate (PubChem CID 155242054) has the molecular formula C35H34O9S and a molecular weight of 630.71 g/mol. Its IUPAC name is 2-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155242054 |
| Molecular Formula | C35H34O9S |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 2-[[9-methyl-7-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(SC(=O)c2ccc3c(c2)C(C)c2cc(OCCOC(=O)C(=C)C)ccc2-3)cc1 |
| InChI | InChI=1S/C35H34O9S/c1-5-32(36)41-16-6-7-17-43-35(39)44-25-9-12-27(13-10-25)45-34(38)24-8-14-28-29-15-11-26(21-31(29)23(4)30(28)20-24)40-18-19-42-33(37)22(2)3/h5,8-15,20-21,23H,1-2,6-7,16-19H2,3-4H3 |
| InChIKey | PBEOFCQBYYVQHJ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|