C38H42O8S — CID 155241548
4-[[9-methyl-7-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]butyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 155241548) has the molecular formula C38H42O8S and a molecular weight of 658.81 g/mol. Its IUPAC name is 4-[[9-methyl-7-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]butyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 4-[[9-methyl-7-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]butyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155241548 |
| Molecular Formula | C38H42O8S |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 4-[[9-methyl-7-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylcarbonyl-9H-fluoren-2-yl]oxy]butyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(SC(=O)c2ccc3c(c2)C(C)c2cc(OCCCCOC(=O)C(=C)COC)ccc2-3)cc1 |
| InChI | InChI=1S/C38H42O8S/c1-25(2)36(39)45-20-8-6-18-43-29-11-14-31(15-12-29)47-38(41)28-10-16-32-33-17-13-30(23-35(33)27(4)34(32)22-28)44-19-7-9-21-46-37(40)26(3)24-42-5/h10-17,22-23,27H,1,3,6-9,18-21,24H2,2,4-5H3 |
| InChIKey | BLLVPDUWOKYGSJ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|