C29H24O6S — CID 155241751
ethenyl (9S)-9-methyl-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]sulfanyl-9H-fluorene-2-carboxylate (PubChem CID 155241751) has the molecular formula C29H24O6S and a molecular weight of 500.57 g/mol. Its IUPAC name is ethenyl (9S)-9-methyl-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]sulfanyl-9H-fluorene-2-carboxylate.
| Compound Name | ethenyl (9S)-9-methyl-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]sulfanyl-9H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 155241751 |
| Molecular Formula | C29H24O6S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | ethenyl (9S)-9-methyl-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]sulfanyl-9H-fluorene-2-carboxylate |
| SMILES | C=COC(=O)c1ccc2c(c1)[C@H](C)c1cc(SC(=O)c3ccc(OCCOC(=O)C=C)cc3)ccc1-2 |
| InChI | InChI=1S/C29H24O6S/c1-4-27(30)35-15-14-34-21-9-6-19(7-10-21)29(32)36-22-11-13-24-23-12-8-20(28(31)33-5-2)16-25(23)18(3)26(24)17-22/h4-13,16-18H,1-2,14-15H2,3H3/t18-/m0/s1 |
| InChIKey | KTRNFDAMRIZLOV-SFHVURJKSA-N |
| XLogP | 6.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|